C23H30N2O2 — CID 56905997
2-[[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-3,5-dimethyl-1H-pyridin-4-one (PubChem CID 56905997) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-3,5-dimethyl-1H-pyridin-4-one.
| Compound Name | 2-[[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-3,5-dimethyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 56905997 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-3,5-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1c[nH]c(CN2CC[C@@](O)(c3ccccc3)[C@H]3CCCC[C@@H]32)c(C)c1=O |
| InChI | InChI=1S/C23H30N2O2/c1-16-14-24-20(17(2)22(16)26)15-25-13-12-23(27,18-8-4-3-5-9-18)19-10-6-7-11-21(19)25/h3-5,8-9,14,19,21,27H,6-7,10-13,15H2,1-2H3,(H,24,26)/t19-,21-,23+/m0/s1 |
| InChIKey | NXKAFBXFDWYKFN-IEIRFRATSA-N |
| XLogP | 3.64 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |