C19H21N5O2 — CID 56906118
N-(2-hydroxyethyl)-4-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-2-carboxamide (PubChem CID 56906118) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-2-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-4-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56906118 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-2-carboxamide |
| SMILES | CC(Nc1ccnc(C(=O)NCCO)c1)c1ccccc1-n1cccn1 |
| InChI | InChI=1S/C19H21N5O2/c1-14(16-5-2-3-6-18(16)24-11-4-8-22-24)23-15-7-9-20-17(13-15)19(26)21-10-12-25/h2-9,11,13-14,25H,10,12H2,1H3,(H,20,23)(H,21,26) |
| InChIKey | DJOFMMMUIOIYSN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |