C14H17N5O4 — CID 56906165
(3aR,6aS)-6-oxo-5-prop-2-enyl-2-[2-(1,2,4-triazol-1-yl)acetyl]-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 56906165) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (3aR,6aS)-6-oxo-5-prop-2-enyl-2-[2-(1,2,4-triazol-1-yl)acetyl]-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aS)-6-oxo-5-prop-2-enyl-2-[2-(1,2,4-triazol-1-yl)acetyl]-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 56906165 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (3aR,6aS)-6-oxo-5-prop-2-enyl-2-[2-(1,2,4-triazol-1-yl)acetyl]-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | C=CCN1C[C@@]2(C(=O)O)CN(C(=O)Cn3cncn3)C[C@H]2C1=O |
| InChI | InChI=1S/C14H17N5O4/c1-2-3-17-6-14(13(22)23)7-18(4-10(14)12(17)21)11(20)5-19-9-15-8-16-19/h2,8-10H,1,3-7H2,(H,22,23)/t10-,14+/m0/s1 |
| InChIKey | BCCPEPXHCHHJEY-IINYFYTJSA-N |
| XLogP | -1.16 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|