C14H22N6O2 — CID 56906352
(4aS,8aR)-1-(2-aminoethyl)-6-[2-(1,2,4-triazol-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56906352) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (4aS,8aR)-1-(2-aminoethyl)-6-[2-(1,2,4-triazol-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(2-aminoethyl)-6-[2-(1,2,4-triazol-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56906352 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (4aS,8aR)-1-(2-aminoethyl)-6-[2-(1,2,4-triazol-1-yl)acetyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | NCCN1C(=O)CC[C@H]2CN(C(=O)Cn3cncn3)CC[C@H]21 |
| InChI | InChI=1S/C14H22N6O2/c15-4-6-20-12-3-5-18(7-11(12)1-2-13(20)21)14(22)8-19-10-16-9-17-19/h9-12H,1-8,15H2/t11-,12+/m0/s1 |
| InChIKey | RAFZSTONUNAMNB-NWDGAFQWSA-N |
| XLogP | -0.92 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |