C16H21F2NO2 — CID 56906622
3-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]propanoic acid (PubChem CID 56906622) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]propanoic acid.
| Compound Name | 3-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 56906622 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCCC(CCc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H21F2NO2/c17-14-6-5-13(15(18)10-14)4-3-12-2-1-8-19(11-12)9-7-16(20)21/h5-6,10,12H,1-4,7-9,11H2,(H,20,21) |
| InChIKey | VMABYNORKSIMQP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |