C16H26N4O — CID 56906800
(4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56906800) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is (4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56906800 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (4aS,8aR)-6-(1H-imidazol-2-ylmethyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC(C)CN1C(=O)CC[C@H]2CN(Cc3ncc[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C16H26N4O/c1-12(2)9-20-14-5-8-19(11-15-17-6-7-18-15)10-13(14)3-4-16(20)21/h6-7,12-14H,3-5,8-11H2,1-2H3,(H,17,18)/t13-,14+/m0/s1 |
| InChIKey | RBBHMYZXOHJBSZ-UONOGXRCSA-N |
| XLogP | 1.88 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |