C19H25N3O4 — CID 56907101
6-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 56907101) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 56907101 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 6-[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(C(=O)N3CC[C@H]4NCCC[C@]4(CO)C3)cc21 |
| InChI | InChI=1S/C19H25N3O4/c1-21-14-9-13(3-4-15(14)26-10-17(21)24)18(25)22-8-5-16-19(11-22,12-23)6-2-7-20-16/h3-4,9,16,20,23H,2,5-8,10-12H2,1H3/t16-,19-/m1/s1 |
| InChIKey | BSHCNOFGIGTVQA-VQIMIIECSA-N |
| XLogP | 0.62 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |