C18H17NO2 — CID 569072
2-benzyl-6-methyl-2-phenyl-3H-1,3-oxazin-4-one (PubChem CID 569072) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-benzyl-6-methyl-2-phenyl-3H-1,3-oxazin-4-one.
| Compound Name | 2-benzyl-6-methyl-2-phenyl-3H-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 569072 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-benzyl-6-methyl-2-phenyl-3H-1,3-oxazin-4-one |
| SMILES | CC1=CC(=O)NC(Cc2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C18H17NO2/c1-14-12-17(20)19-18(21-14,16-10-6-3-7-11-16)13-15-8-4-2-5-9-15/h2-12H,13H2,1H3,(H,19,20) |
| InChIKey | HPYONWAWULJWCV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |