C19H19N5O2 — CID 56907203
2,1-benzoxazol-3-yl-[4-(prop-2-enylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone (PubChem CID 56907203) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2,1-benzoxazol-3-yl-[4-(prop-2-enylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone.
| Compound Name | 2,1-benzoxazol-3-yl-[4-(prop-2-enylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone |
|---|---|
| PubChem CID | 56907203 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2,1-benzoxazol-3-yl-[4-(prop-2-enylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]methanone |
| SMILES | C=CCNc1ncnc2c1CCN(C(=O)c1onc3ccccc13)CC2 |
| InChI | InChI=1S/C19H19N5O2/c1-2-9-20-18-14-7-10-24(11-8-15(14)21-12-22-18)19(25)17-13-5-3-4-6-16(13)23-26-17/h2-6,12H,1,7-11H2,(H,20,21,22) |
| InChIKey | VVMTYNLCOULVAC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|