C19H23N5S — CID 56907273
N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)methanamine (PubChem CID 56907273) has the molecular formula C19H23N5S and a molecular weight of 353.50 g/mol. Its IUPAC name is N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)methanamine.
| Compound Name | N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)methanamine |
|---|---|
| PubChem CID | 56907273 |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)methanamine |
| SMILES | CN(Cc1cc2n(n1)CCCNC2)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H23N5S/c1-23(12-16-10-17-11-20-8-5-9-24(17)22-16)13-19-21-18(14-25-19)15-6-3-2-4-7-15/h2-4,6-7,10,14,20H,5,8-9,11-13H2,1H3 |
| InChIKey | NBIODSUCIDOGOA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |