C13H18FN5O — CID 56907444
[4-(5-fluoropyrimidin-2-yl)piperazin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 56907444) has the molecular formula C13H18FN5O and a molecular weight of 279.32 g/mol. Its IUPAC name is [4-(5-fluoropyrimidin-2-yl)piperazin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(5-fluoropyrimidin-2-yl)piperazin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 56907444 |
| Molecular Formula | C13H18FN5O |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [4-(5-fluoropyrimidin-2-yl)piperazin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CN(c2ncc(F)cn2)CCN1)N1CCCC1 |
| InChI | InChI=1S/C13H18FN5O/c14-10-7-16-13(17-8-10)19-6-3-15-11(9-19)12(20)18-4-1-2-5-18/h7-8,11,15H,1-6,9H2 |
| InChIKey | GZCMJXOAWJZDOY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |