C13H16N6S — CID 56908202
4-[3-[(5-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]-1,3-thiazol-2-amine (PubChem CID 56908202) has the molecular formula C13H16N6S and a molecular weight of 288.38 g/mol. Its IUPAC name is 4-[3-[(5-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-[(5-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 56908202 |
| Molecular Formula | C13H16N6S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-[3-[(5-methylpyrazolo[1,5-a]pyrimidin-7-yl)amino]propyl]-1,3-thiazol-2-amine |
| SMILES | Cc1cc(NCCCc2csc(N)n2)n2nccc2n1 |
| InChI | InChI=1S/C13H16N6S/c1-9-7-12(19-11(17-9)4-6-16-19)15-5-2-3-10-8-20-13(14)18-10/h4,6-8,15H,2-3,5H2,1H3,(H2,14,18) |
| InChIKey | ROSDTXUMJQQNEJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|