C17H21FN6O — CID 56908246
(4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56908246) has the molecular formula C17H21FN6O and a molecular weight of 344.39 g/mol. Its IUPAC name is (4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56908246 |
| Molecular Formula | C17H21FN6O |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (4aS,8aR)-6-(5-fluoropyrimidin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@H]2CN(c3ncc(F)cn3)CC[C@H]2N1CCc1cnc[nH]1 |
| InChI | InChI=1S/C17H21FN6O/c18-13-7-20-17(21-8-13)23-5-4-15-12(10-23)1-2-16(25)24(15)6-3-14-9-19-11-22-14/h7-9,11-12,15H,1-6,10H2,(H,19,22)/t12-,15+/m0/s1 |
| InChIKey | UFGKOMNGMGAAMK-SWLSCSKDSA-N |
| XLogP | 1.40 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |