C18H26N6S — CID 56909323
7-(cyclopentylmethyl)-4-N-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56909323) has the molecular formula C18H26N6S and a molecular weight of 358.52 g/mol. Its IUPAC name is 7-(cyclopentylmethyl)-4-N-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 7-(cyclopentylmethyl)-4-N-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56909323 |
| Molecular Formula | C18H26N6S |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 7-(cyclopentylmethyl)-4-N-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(NCc3nccs3)n1)CCN(CC1CCCC1)CC2 |
| InChI | InChI=1S/C18H26N6S/c19-18-22-15-6-9-24(12-13-3-1-2-4-13)8-5-14(15)17(23-18)21-11-16-20-7-10-25-16/h7,10,13H,1-6,8-9,11-12H2,(H3,19,21,22,23) |
| InChIKey | SPTJBYSDDWEIMI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |