About 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid
2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid (PubChem CID 56909334) has the molecular formula C11H17N3O5S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid |
| PubChem CID | 56909334 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid |
| SMILES | Cc1nc(S(=O)(=O)N2CCOCC2CC(=O)O)cn1C |
| InChI | InChI=1S/C11H17N3O5S/c1-8-12-10(6-13(8)2)20(17,18)14-3-4-19-7-9(14)5-11(15)16/h6,9H,3-5,7H2,1-2H3,(H,15,16) |
| InChIKey | OYEDTEZKSXCEKG-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid?
The IUPAC name of 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid (CID 56909334) is 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid.
What is the SMILES notation for 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid?
The canonical SMILES for 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid is Cc1nc(S(=O)(=O)N2CCOCC2CC(=O)O)cn1C.
What is the InChIKey of 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid?
The InChIKey is OYEDTEZKSXCEKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O5S/c1-8-12-10(6-13(8)2)20(17,18)14-3-4-19-7-9(14)5-11(15)16/h6,9H,3-5,7H2,1-2H3,(H,15,16).
What are the key properties of 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid?
2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid has a molecular weight of 303.34 g/mol, XLogP of -0.41, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,2-dimethylimidazol-4-yl)sulfonylmorpholin-3-yl]acetic acid is sourced from PubChem (CID 56909334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).