About N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine
N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine (PubChem CID 56909424) has the molecular formula C18H30N4O2
and a molecular weight of 334.46 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine |
| PubChem CID | 56909424 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine |
| SMILES | C=CCCC(CN1CCCOCC1)Oc1nccc(N(C)CC)n1 |
| InChI | InChI=1S/C18H30N4O2/c1-4-6-8-16(15-22-11-7-13-23-14-12-22)24-18-19-10-9-17(20-18)21(3)5-2/h4,9-10,16H,1,5-8,11-15H2,2-3H3 |
| InChIKey | LRNNCSZDGKGQCI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine?
The IUPAC name of N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine (CID 56909424) is N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine.
What is the SMILES notation for N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine?
The canonical SMILES for N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine is C=CCCC(CN1CCCOCC1)Oc1nccc(N(C)CC)n1.
What is the InChIKey of N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine?
The InChIKey is LRNNCSZDGKGQCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O2/c1-4-6-8-16(15-22-11-7-13-23-14-12-22)24-18-19-10-9-17(20-18)21(3)5-2/h4,9-10,16H,1,5-8,11-15H2,2-3H3.
What are the key properties of N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine?
N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine has a molecular weight of 334.46 g/mol, XLogP of 2.37, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-2-[1-(1,4-oxazepan-4-yl)hex-5-en-2-yloxy]pyrimidin-4-amine is sourced from PubChem (CID 56909424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).