About 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one
4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one (PubChem CID 56909611) has the molecular formula C19H20N4O3
and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one.
Molecular Properties
| Compound Name | 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one |
| PubChem CID | 56909611 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one |
| SMILES | COc1cccc(CN2CCN(Cc3ccc4nonc4c3)CC2=O)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-25-16-4-2-3-14(9-16)12-23-8-7-22(13-19(23)24)11-15-5-6-17-18(10-15)21-26-20-17/h2-6,9-10H,7-8,11-13H2,1H3 |
| InChIKey | AMYCMEFPTLGSEM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one?
The IUPAC name of 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one (CID 56909611) is 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one.
What is the SMILES notation for 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one?
The canonical SMILES for 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one is COc1cccc(CN2CCN(Cc3ccc4nonc4c3)CC2=O)c1.
What is the InChIKey of 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one?
The InChIKey is AMYCMEFPTLGSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3/c1-25-16-4-2-3-14(9-16)12-23-8-7-22(13-19(23)24)11-15-5-6-17-18(10-15)21-26-20-17/h2-6,9-10H,7-8,11-13H2,1H3.
What are the key properties of 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one?
4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one has a molecular weight of 352.39 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,1,3-benzoxadiazol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]piperazin-2-one is sourced from PubChem (CID 56909611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).