C16H20F3N3 — CID 56909813
(3aR,7aS)-2-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56909813) has the molecular formula C16H20F3N3 and a molecular weight of 311.35 g/mol. Its IUPAC name is (3aR,7aS)-2-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56909813 |
| Molecular Formula | C16H20F3N3 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3aR,7aS)-2-[6-propan-2-yl-2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | CC(C)c1cc(N2C[C@H]3CC=CC[C@H]3C2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H20F3N3/c1-10(2)13-7-14(21-15(20-13)16(17,18)19)22-8-11-5-3-4-6-12(11)9-22/h3-4,7,10-12H,5-6,8-9H2,1-2H3/t11-,12+ |
| InChIKey | WJUNFXIDMQKCRC-TXEJJXNPSA-N |
| XLogP | 4.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|