C19H33N5O — CID 56910058
N,N,4-trimethyl-6-[1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yloxy]pyrimidin-2-amine (PubChem CID 56910058) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is N,N,4-trimethyl-6-[1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yloxy]pyrimidin-2-amine.
| Compound Name | N,N,4-trimethyl-6-[1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yloxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56910058 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | N,N,4-trimethyl-6-[1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yloxy]pyrimidin-2-amine |
| SMILES | C=CCCC(CN1CCCN(C)CC1)Oc1cc(C)nc(N(C)C)n1 |
| InChI | InChI=1S/C19H33N5O/c1-6-7-9-17(15-24-11-8-10-23(5)12-13-24)25-18-14-16(2)20-19(21-18)22(3)4/h6,14,17H,1,7-13,15H2,2-5H3 |
| InChIKey | LBSZUYQQLWFVQA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|