About 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide
2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 56910242) has the molecular formula C11H9N5OS
and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 56910242 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(-c2cc(N)nc3[nH]ccc23)n1 |
| InChI | InChI=1S/C11H9N5OS/c12-8-3-6(5-1-2-14-10(5)16-8)11-15-7(4-18-11)9(13)17/h1-4H,(H2,13,17)(H3,12,14,16) |
| InChIKey | GAPMZXJJFXOHSJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide (CID 56910242) is 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide is NC(=O)c1csc(-c2cc(N)nc3[nH]ccc23)n1.
What is the InChIKey of 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide?
The InChIKey is GAPMZXJJFXOHSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5OS/c12-8-3-6(5-1-2-14-10(5)16-8)11-15-7(4-18-11)9(13)17/h1-4H,(H2,13,17)(H3,12,14,16).
What are the key properties of 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide?
2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide has a molecular weight of 259.29 g/mol, XLogP of 1.37, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 56910242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).