C24H27N3O2 — CID 56910824
1,3,7-trimethyl-N-[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]indole-2-carboxamide (PubChem CID 56910824) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1,3,7-trimethyl-N-[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]indole-2-carboxamide.
| Compound Name | 1,3,7-trimethyl-N-[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]indole-2-carboxamide |
|---|---|
| PubChem CID | 56910824 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1,3,7-trimethyl-N-[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC(=O)N(CCc3ccccc3)C2)n(C)c2c(C)cccc12 |
| InChI | InChI=1S/C24H27N3O2/c1-16-8-7-11-20-17(2)23(26(3)22(16)20)24(29)25-19-14-21(28)27(15-19)13-12-18-9-5-4-6-10-18/h4-11,19H,12-15H2,1-3H3,(H,25,29) |
| InChIKey | AWZZVNZIGRMFMN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|