C17H22FN5 — CID 56911065
4-N-[2-(4-fluorophenyl)ethyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine (PubChem CID 56911065) has the molecular formula C17H22FN5 and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-N-[2-(4-fluorophenyl)ethyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(4-fluorophenyl)ethyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 56911065 |
| Molecular Formula | C17H22FN5 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4-N-[2-(4-fluorophenyl)ethyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc2c(c(NCCc3ccc(F)cc3)n1)CCNC2 |
| InChI | InChI=1S/C17H22FN5/c1-23(2)17-21-15-11-19-9-8-14(15)16(22-17)20-10-7-12-3-5-13(18)6-4-12/h3-6,19H,7-11H2,1-2H3,(H,20,21,22) |
| InChIKey | GUFYNDKNZRBXES-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |