C16H23N5 — CID 56911215
4-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-amine (PubChem CID 56911215) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 4-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-amine.
| Compound Name | 4-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-amine |
|---|---|
| PubChem CID | 56911215 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-amine |
| SMILES | Nc1nc2c(c(N3C[C@H]4CC=CC[C@H]4C3)n1)CCNCC2 |
| InChI | InChI=1S/C16H23N5/c17-16-19-14-6-8-18-7-5-13(14)15(20-16)21-9-11-3-1-2-4-12(11)10-21/h1-2,11-12,18H,3-10H2,(H2,17,19,20)/t11-,12+ |
| InChIKey | YSPJLDCCUGHWCC-TXEJJXNPSA-N |
| XLogP | 1.15 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|