C17H16N4O2 — CID 56911653
4-furo[3,2-c]pyridin-4-yl-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 56911653) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-furo[3,2-c]pyridin-4-yl-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | 4-furo[3,2-c]pyridin-4-yl-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 56911653 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-furo[3,2-c]pyridin-4-yl-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | COCCNc1cc(-c2nccc3occc23)c2cc[nH]c2n1 |
| InChI | InChI=1S/C17H16N4O2/c1-22-9-7-18-15-10-13(11-2-5-20-17(11)21-15)16-12-4-8-23-14(12)3-6-19-16/h2-6,8,10H,7,9H2,1H3,(H2,18,20,21) |
| InChIKey | KPLUOBHUIZSVCI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|