C14H21NO4S — CID 56912060
[4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[5-(methoxymethyl)thiophen-2-yl]methanone (PubChem CID 56912060) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is [4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[5-(methoxymethyl)thiophen-2-yl]methanone.
| Compound Name | [4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[5-(methoxymethyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 56912060 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[5-(methoxymethyl)thiophen-2-yl]methanone |
| SMILES | COCc1ccc(C(=O)N2CCCC(O)(CO)CC2)s1 |
| InChI | InChI=1S/C14H21NO4S/c1-19-9-11-3-4-12(20-11)13(17)15-7-2-5-14(18,10-16)6-8-15/h3-4,16,18H,2,5-10H2,1H3 |
| InChIKey | ZDAIKNSRSJWRMO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |