C11H14N2O2S2 — CID 56912209
1-(2-methylsulfonylethyl)-2-(3-methylthiophen-2-yl)imidazole (PubChem CID 56912209) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(2-methylsulfonylethyl)-2-(3-methylthiophen-2-yl)imidazole.
| Compound Name | 1-(2-methylsulfonylethyl)-2-(3-methylthiophen-2-yl)imidazole |
|---|---|
| PubChem CID | 56912209 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-(2-methylsulfonylethyl)-2-(3-methylthiophen-2-yl)imidazole |
| SMILES | Cc1ccsc1-c1nccn1CCS(C)(=O)=O |
| InChI | InChI=1S/C11H14N2O2S2/c1-9-3-7-16-10(9)11-12-4-5-13(11)6-8-17(2,14)15/h3-5,7H,6,8H2,1-2H3 |
| InChIKey | GBBKQMASHKXTCV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |