About [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol
[2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol (PubChem CID 56912725) has the molecular formula C11H9N3OS
and a molecular weight of 231.28 g/mol. Its IUPAC name is [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol |
| PubChem CID | 56912725 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1csc(-c2ccnc3[nH]ccc23)n1 |
| InChI | InChI=1S/C11H9N3OS/c15-5-7-6-16-11(14-7)9-2-4-13-10-8(9)1-3-12-10/h1-4,6,15H,5H2,(H,12,13) |
| InChIKey | DEQVBJXGQZCGGU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol?
The IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol (CID 56912725) is [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol.
What is the SMILES notation for [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol?
The canonical SMILES for [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol is OCc1csc(-c2ccnc3[nH]ccc23)n1.
What is the InChIKey of [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol?
The InChIKey is DEQVBJXGQZCGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3OS/c15-5-7-6-16-11(14-7)9-2-4-13-10-8(9)1-3-12-10/h1-4,6,15H,5H2,(H,12,13).
What are the key properties of [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol?
[2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol has a molecular weight of 231.28 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-thiazol-4-yl]methanol is sourced from PubChem (CID 56912725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).