C17H11F6N3 — CID 569130
2,6-diphenyl-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine (PubChem CID 569130) has the molecular formula C17H11F6N3 and a molecular weight of 371.28 g/mol. Its IUPAC name is 2,6-diphenyl-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine.
| Compound Name | 2,6-diphenyl-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 569130 |
| Molecular Formula | C17H11F6N3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2,6-diphenyl-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine |
| SMILES | FC(F)(F)C1(C(F)(F)F)N=C(c2ccccc2)NC(c2ccccc2)=N1 |
| InChI | InChI=1S/C17H11F6N3/c18-16(19,20)15(17(21,22)23)25-13(11-7-3-1-4-8-11)24-14(26-15)12-9-5-2-6-10-12/h1-10H,(H,24,25,26) |
| InChIKey | UDWCMBHZUNQXPA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |