C18H29N5O — CID 56913021
2-methyl-N-[3-(pyridin-3-ylamino)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 56913021) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-methyl-N-[3-(pyridin-3-ylamino)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | 2-methyl-N-[3-(pyridin-3-ylamino)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 56913021 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 2-methyl-N-[3-(pyridin-3-ylamino)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CN1CC2(CCNCC2)CC1C(=O)NCCCNc1cccnc1 |
| InChI | InChI=1S/C18H29N5O/c1-23-14-18(5-10-19-11-6-18)12-16(23)17(24)22-9-3-8-21-15-4-2-7-20-13-15/h2,4,7,13,16,19,21H,3,5-6,8-12,14H2,1H3,(H,22,24) |
| InChIKey | RVQPKPIWARRZMA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|