C18H25N5O3 — CID 56913104
4-(3-tert-butylpyrazol-1-yl)-1-(3-methoxypyrazin-2-yl)piperidine-4-carboxylic acid (PubChem CID 56913104) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-(3-tert-butylpyrazol-1-yl)-1-(3-methoxypyrazin-2-yl)piperidine-4-carboxylic acid.
| Compound Name | 4-(3-tert-butylpyrazol-1-yl)-1-(3-methoxypyrazin-2-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56913104 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-(3-tert-butylpyrazol-1-yl)-1-(3-methoxypyrazin-2-yl)piperidine-4-carboxylic acid |
| SMILES | COc1nccnc1N1CCC(C(=O)O)(n2ccc(C(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C18H25N5O3/c1-17(2,3)13-5-10-23(21-13)18(16(24)25)6-11-22(12-7-18)14-15(26-4)20-9-8-19-14/h5,8-10H,6-7,11-12H2,1-4H3,(H,24,25) |
| InChIKey | GYQQRJINGFVPQO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |