C19H25N5S — CID 56913323
N-(2-cyclopropyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (PubChem CID 56913323) has the molecular formula C19H25N5S and a molecular weight of 355.51 g/mol. Its IUPAC name is N-(2-cyclopropyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine.
| Compound Name | N-(2-cyclopropyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 56913323 |
| Molecular Formula | C19H25N5S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-(2-cyclopropyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| SMILES | Cc1nc2c(s1)CCCC2Nc1nc(C2CC2)nc2c1CCNCC2 |
| InChI | InChI=1S/C19H25N5S/c1-11-21-17-15(3-2-4-16(17)25-11)23-19-13-7-9-20-10-8-14(13)22-18(24-19)12-5-6-12/h12,15,20H,2-10H2,1H3,(H,22,23,24) |
| InChIKey | KMOZDYCGFGFCMN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |