About 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane
4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane (PubChem CID 56913523) has the molecular formula C16H25N3O2
and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane |
| PubChem CID | 56913523 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane |
| SMILES | C=CCCC(CN1CCCOCC1)Oc1nccc(C)n1 |
| InChI | InChI=1S/C16H25N3O2/c1-3-4-6-15(13-19-9-5-11-20-12-10-19)21-16-17-8-7-14(2)18-16/h3,7-8,15H,1,4-6,9-13H2,2H3 |
| InChIKey | GWZLXTSMPXUPAJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane?
The IUPAC name of 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane (CID 56913523) is 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane.
What is the SMILES notation for 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane?
The canonical SMILES for 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane is C=CCCC(CN1CCCOCC1)Oc1nccc(C)n1.
What is the InChIKey of 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane?
The InChIKey is GWZLXTSMPXUPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-3-4-6-15(13-19-9-5-11-20-12-10-19)21-16-17-8-7-14(2)18-16/h3,7-8,15H,1,4-6,9-13H2,2H3.
What are the key properties of 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane?
4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane has a molecular weight of 291.39 g/mol, XLogP of 2.22, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane is sourced from PubChem (CID 56913523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).