C18H26N6O2 — CID 56913668
2-cyclopentyl-N-[[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 56913668) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-cyclopentyl-N-[[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-cyclopentyl-N-[[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 56913668 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-cyclopentyl-N-[[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | COCc1noc(CNc2nc(C3CCCC3)nc3c2CCNCC3)n1 |
| InChI | InChI=1S/C18H26N6O2/c1-25-11-15-22-16(26-24-15)10-20-18-13-6-8-19-9-7-14(13)21-17(23-18)12-4-2-3-5-12/h12,19H,2-11H2,1H3,(H,20,21,23) |
| InChIKey | ADNFHFPCMISOEB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |