About [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone
[6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone (PubChem CID 56913722) has the molecular formula C16H25N5O2
and a molecular weight of 319.41 g/mol. Its IUPAC name is [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone |
| PubChem CID | 56913722 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cncc(NC[C@@H]2CCNC[C@H]2O)n1)N1CCCCC1 |
| InChI | InChI=1S/C16H25N5O2/c22-14-10-17-5-4-12(14)8-19-15-11-18-9-13(20-15)16(23)21-6-2-1-3-7-21/h9,11-12,14,17,22H,1-8,10H2,(H,19,20)/t12-,14+/m0/s1 |
| InChIKey | HGFXYFZACSJWJV-GXTWGEPZSA-N |
| XLogP | 0.49 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone?
The IUPAC name of [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone (CID 56913722) is [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone?
The canonical SMILES for [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone is O=C(c1cncc(NC[C@@H]2CCNC[C@H]2O)n1)N1CCCCC1.
What is the InChIKey of [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone?
The InChIKey is HGFXYFZACSJWJV-GXTWGEPZSA-N. The full InChI is InChI=1S/C16H25N5O2/c22-14-10-17-5-4-12(14)8-19-15-11-18-9-13(20-15)16(23)21-6-2-1-3-7-21/h9,11-12,14,17,22H,1-8,10H2,(H,19,20)/t12-,14+/m0/s1.
What are the key properties of [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone?
[6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone has a molecular weight of 319.41 g/mol, XLogP of 0.49, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[[(3S,4S)-3-hydroxypiperidin-4-yl]methylamino]pyrazin-2-yl]-piperidin-1-ylmethanone is sourced from PubChem (CID 56913722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).