C18H30N2O — CID 56914001
(4aS,8aR)-6-cyclopent-3-en-1-yl-1-(3-methylbutyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56914001) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (4aS,8aR)-6-cyclopent-3-en-1-yl-1-(3-methylbutyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-cyclopent-3-en-1-yl-1-(3-methylbutyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56914001 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (4aS,8aR)-6-cyclopent-3-en-1-yl-1-(3-methylbutyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC(C)CCN1C(=O)CC[C@H]2CN(C3CC=CC3)CC[C@H]21 |
| InChI | InChI=1S/C18H30N2O/c1-14(2)9-12-20-17-10-11-19(16-5-3-4-6-16)13-15(17)7-8-18(20)21/h3-4,14-17H,5-13H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | PUUHAWHBVPVDMP-DOTOQJQBSA-N |
| XLogP | 3.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|