C18H27N7O — CID 56914111
7-(oxolan-3-ylmethyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 56914111) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 7-(oxolan-3-ylmethyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 7-(oxolan-3-ylmethyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 56914111 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 7-(oxolan-3-ylmethyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | c1nc2c(c(NCCCn3cncn3)n1)CCN(CC1CCOC1)CC2 |
| InChI | InChI=1S/C18H27N7O/c1(6-25-14-19-12-23-25)5-20-18-16-2-7-24(10-15-4-9-26-11-15)8-3-17(16)21-13-22-18/h12-15H,1-11H2,(H,20,21,22) |
| InChIKey | BGBWHJYEMPCLFX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|