C19H27N3O3 — CID 56914444
(4aS,8aR)-6-(1-methyl-2-oxopyridine-4-carbonyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56914444) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (4aS,8aR)-6-(1-methyl-2-oxopyridine-4-carbonyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(1-methyl-2-oxopyridine-4-carbonyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56914444 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (4aS,8aR)-6-(1-methyl-2-oxopyridine-4-carbonyl)-1-(2-methylpropyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC(C)CN1C(=O)CC[C@H]2CN(C(=O)c3ccn(C)c(=O)c3)CC[C@H]21 |
| InChI | InChI=1S/C19H27N3O3/c1-13(2)11-22-16-7-9-21(12-15(16)4-5-17(22)23)19(25)14-6-8-20(3)18(24)10-14/h6,8,10,13,15-16H,4-5,7,9,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | DIPPPHNUPMNUBR-JKSUJKDBSA-N |
| XLogP | 1.49 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |