C20H29N3O3 — CID 56914471
2-[1-(2,3-dihydro-1H-inden-2-yl)-3-oxopiperazin-2-yl]-N-(2-propoxyethyl)acetamide (PubChem CID 56914471) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[1-(2,3-dihydro-1H-inden-2-yl)-3-oxopiperazin-2-yl]-N-(2-propoxyethyl)acetamide.
| Compound Name | 2-[1-(2,3-dihydro-1H-inden-2-yl)-3-oxopiperazin-2-yl]-N-(2-propoxyethyl)acetamide |
|---|---|
| PubChem CID | 56914471 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-[1-(2,3-dihydro-1H-inden-2-yl)-3-oxopiperazin-2-yl]-N-(2-propoxyethyl)acetamide |
| SMILES | CCCOCCNC(=O)CC1C(=O)NCCN1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-10-26-11-8-21-19(24)14-18-20(25)22-7-9-23(18)17-12-15-5-3-4-6-16(15)13-17/h3-6,17-18H,2,7-14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | RANBVYAVLZAMEF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|