C18H27N7O — CID 56914633
7-[(1-ethylpyrazol-4-yl)methyl]-4-N-(oxolan-3-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56914633) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 7-[(1-ethylpyrazol-4-yl)methyl]-4-N-(oxolan-3-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 7-[(1-ethylpyrazol-4-yl)methyl]-4-N-(oxolan-3-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56914633 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 7-[(1-ethylpyrazol-4-yl)methyl]-4-N-(oxolan-3-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CCn1cc(CN2CCc3nc(N)nc(NC4CCOC4)c3CC2)cn1 |
| InChI | InChI=1S/C18H27N7O/c1-2-25-11-13(9-20-25)10-24-6-3-15-16(4-7-24)22-18(19)23-17(15)21-14-5-8-26-12-14/h9,11,14H,2-8,10,12H2,1H3,(H3,19,21,22,23) |
| InChIKey | YGPVCYWXCORZKT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |