C20H28N6 — CID 56915650
4-N-methyl-4-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56915650) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 4-N-methyl-4-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-methyl-4-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56915650 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-N-methyl-4-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CN(CC1Cc2ccccc2CN1C)c1nc(N)nc2c1CCNCC2 |
| InChI | InChI=1S/C20H28N6/c1-25-12-15-6-4-3-5-14(15)11-16(25)13-26(2)19-17-7-9-22-10-8-18(17)23-20(21)24-19/h3-6,16,22H,7-13H2,1-2H3,(H2,21,23,24) |
| InChIKey | BBAIJUXQFGKGPB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |