C18H27N7O — CID 56915804
1-[2-methyl-4-(propylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one (PubChem CID 56915804) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-[2-methyl-4-(propylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one.
| Compound Name | 1-[2-methyl-4-(propylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 56915804 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[2-methyl-4-(propylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one |
| SMILES | CCCNc1nc(C)nc2c1CCN(C(=O)CCc1n[nH]c(C)n1)CC2 |
| InChI | InChI=1S/C18H27N7O/c1-4-9-19-18-14-7-10-25(11-8-15(14)20-12(2)22-18)17(26)6-5-16-21-13(3)23-24-16/h4-11H2,1-3H3,(H,19,20,22)(H,21,23,24) |
| InChIKey | WCNDISIWMQODQP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |