About 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol
1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol (PubChem CID 56916014) has the molecular formula C14H21Cl2N3O
and a molecular weight of 318.25 g/mol. Its IUPAC name is 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol.
Molecular Properties
| Compound Name | 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol |
| PubChem CID | 56916014 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol |
| SMILES | CN(C)CC1(O)CCCN(Cc2c(Cl)cncc2Cl)C1 |
| InChI | InChI=1S/C14H21Cl2N3O/c1-18(2)9-14(20)4-3-5-19(10-14)8-11-12(15)6-17-7-13(11)16/h6-7,20H,3-5,8-10H2,1-2H3 |
| InChIKey | ZRAWOLOUKIZGAL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol?
The IUPAC name of 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol (CID 56916014) is 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol.
What is the SMILES notation for 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol?
The canonical SMILES for 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol is CN(C)CC1(O)CCCN(Cc2c(Cl)cncc2Cl)C1.
What is the InChIKey of 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol?
The InChIKey is ZRAWOLOUKIZGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Cl2N3O/c1-18(2)9-14(20)4-3-5-19(10-14)8-11-12(15)6-17-7-13(11)16/h6-7,20H,3-5,8-10H2,1-2H3.
What are the key properties of 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol?
1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol has a molecular weight of 318.25 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichloro-4-pyridinyl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol is sourced from PubChem (CID 56916014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).