C19H27N5O2 — CID 56916110
4-N-[(2,4-dimethoxyphenyl)methyl]-2-N,2-N-dimethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56916110) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-N-[(2,4-dimethoxyphenyl)methyl]-2-N,2-N-dimethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[(2,4-dimethoxyphenyl)methyl]-2-N,2-N-dimethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56916110 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 4-N-[(2,4-dimethoxyphenyl)methyl]-2-N,2-N-dimethyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | COc1ccc(CNc2nc(N(C)C)nc3c2CCNCC3)c(OC)c1 |
| InChI | InChI=1S/C19H27N5O2/c1-24(2)19-22-16-8-10-20-9-7-15(16)18(23-19)21-12-13-5-6-14(25-3)11-17(13)26-4/h5-6,11,20H,7-10,12H2,1-4H3,(H,21,22,23) |
| InChIKey | MLJXLEAWZDGGAG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |