C15H26N4O2S — CID 56916355
5-[2-(2-aminoethyl)morpholin-4-yl]-2-(2-propan-2-ylsulfanylethyl)pyridazin-3-one (PubChem CID 56916355) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is 5-[2-(2-aminoethyl)morpholin-4-yl]-2-(2-propan-2-ylsulfanylethyl)pyridazin-3-one.
| Compound Name | 5-[2-(2-aminoethyl)morpholin-4-yl]-2-(2-propan-2-ylsulfanylethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 56916355 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 5-[2-(2-aminoethyl)morpholin-4-yl]-2-(2-propan-2-ylsulfanylethyl)pyridazin-3-one |
| SMILES | CC(C)SCCn1ncc(N2CCOC(CCN)C2)cc1=O |
| InChI | InChI=1S/C15H26N4O2S/c1-12(2)22-8-6-19-15(20)9-13(10-17-19)18-5-7-21-14(11-18)3-4-16/h9-10,12,14H,3-8,11,16H2,1-2H3 |
| InChIKey | MFTOVZGDUACOTB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |