C15H26N4O4S — CID 56916459
N-[[1-[2-(2-ethylimidazol-1-yl)acetyl]-4-hydroxyazepan-4-yl]methyl]methanesulfonamide (PubChem CID 56916459) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is N-[[1-[2-(2-ethylimidazol-1-yl)acetyl]-4-hydroxyazepan-4-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-[2-(2-ethylimidazol-1-yl)acetyl]-4-hydroxyazepan-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 56916459 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[[1-[2-(2-ethylimidazol-1-yl)acetyl]-4-hydroxyazepan-4-yl]methyl]methanesulfonamide |
| SMILES | CCc1nccn1CC(=O)N1CCCC(O)(CNS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H26N4O4S/c1-3-13-16-7-10-19(13)11-14(20)18-8-4-5-15(21,6-9-18)12-17-24(2,22)23/h7,10,17,21H,3-6,8-9,11-12H2,1-2H3 |
| InChIKey | ZXDXHRYYBQPOIZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |