C17H25N5O3 — CID 56916776
(4aS,8aR)-6-(6-morpholin-4-ylpyrimidin-4-yl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid (PubChem CID 56916776) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is (4aS,8aR)-6-(6-morpholin-4-ylpyrimidin-4-yl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aR)-6-(6-morpholin-4-ylpyrimidin-4-yl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 56916776 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (4aS,8aR)-6-(6-morpholin-4-ylpyrimidin-4-yl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid |
| SMILES | O=C(O)[C@]12CCCN[C@@H]1CCN(c1cc(N3CCOCC3)ncn1)C2 |
| InChI | InChI=1S/C17H25N5O3/c23-16(24)17-3-1-4-18-13(17)2-5-22(11-17)15-10-14(19-12-20-15)21-6-8-25-9-7-21/h10,12-13,18H,1-9,11H2,(H,23,24)/t13-,17+/m1/s1 |
| InChIKey | MABIKRUJONOHOB-DYVFJYSZSA-N |
| XLogP | 0.35 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |