C11H15F3N4O — CID 56917547
N-[2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]ethyl]acetamide (PubChem CID 56917547) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is N-[2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 56917547 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-[2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nccc(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N4O/c1-8(19)15-6-7-17-10-16-5-3-9(18-10)2-4-11(12,13)14/h3,5H,2,4,6-7H2,1H3,(H,15,19)(H,16,17,18) |
| InChIKey | ANICBIIQIHHUBN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|