C13H19N3O — CID 56917654
(E)-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)hex-3-en-1-one (PubChem CID 56917654) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (E)-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)hex-3-en-1-one.
| Compound Name | (E)-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)hex-3-en-1-one |
|---|---|
| PubChem CID | 56917654 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (E)-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)hex-3-en-1-one |
| SMILES | CC/C=C/CC(=O)N1CCCn2cncc2C1 |
| InChI | InChI=1S/C13H19N3O/c1-2-3-4-6-13(17)15-7-5-8-16-11-14-9-12(16)10-15/h3-4,9,11H,2,5-8,10H2,1H3/b4-3+ |
| InChIKey | BFOCZTNQADWUCX-ONEGZZNKSA-N |
| XLogP | 1.97 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|