About 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane
4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane (PubChem CID 56917708) has the molecular formula C16H26N2O3S
and a molecular weight of 326.46 g/mol. Its IUPAC name is 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane.
Molecular Properties
| Compound Name | 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane |
| PubChem CID | 56917708 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane |
| SMILES | CCN(C1CCOC(C)(C)C1)S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-4-18(15-10-11-21-16(2,3)12-15)22(19,20)17-13-14-8-6-5-7-9-14/h5-9,15,17H,4,10-13H2,1-3H3 |
| InChIKey | AKTWTGRPOQCQTC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane?
The IUPAC name of 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane (CID 56917708) is 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane.
What is the SMILES notation for 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane?
The canonical SMILES for 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane is CCN(C1CCOC(C)(C)C1)S(=O)(=O)NCc1ccccc1.
What is the InChIKey of 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane?
The InChIKey is AKTWTGRPOQCQTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3S/c1-4-18(15-10-11-21-16(2,3)12-15)22(19,20)17-13-14-8-6-5-7-9-14/h5-9,15,17H,4,10-13H2,1-3H3.
What are the key properties of 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane?
4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane has a molecular weight of 326.46 g/mol, XLogP of 2.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[benzylsulfamoyl(ethyl)amino]-2,2-dimethyloxane is sourced from PubChem (CID 56917708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).