C17H20N4O2 — CID 56918032
6-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 56918032) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56918032 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3cnc4cc(C)[nH]n4c3=O)C[C@@H]2C1 |
| InChI | InChI=1S/C17H20N4O2/c1-10-3-4-12-8-20(9-13(12)5-10)16(22)14-7-18-15-6-11(2)19-21(15)17(14)23/h3,6-7,12-13,19H,4-5,8-9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | GVUYUFWLWGYMRT-OLZOCXBDSA-N |
| XLogP | 1.76 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|